CMap Candidate Details
Structure:
| CMap ID: | C03689 |
| Pert ID: | BRD-K97752965 |
| Compound Name: | nicorandil |
| Targets: | KCNJ11 |
| MoA: | nitric oxide donor; potassium channel activator |
| SMILES: | [O-][N+](=O)OCCNC(=O)c1cccnc1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 24514 | BRD-K97752965 | A375 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 24706 | BRD-K97752965 | A549 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 24974 | BRD-K97752965 | HT29 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 25059 | BRD-K97752965 | MCF??7.00 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.3 | -1.01 | 0.57 |
| 25458 | BRD-K97752965 | VCAP | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 51535 | BRD-K97752965 | PC3 | 10 uM | 24 h | -0.22 | -0.91 | 0.05 | 0.28 | 0.98 | 0.37 |
| 91110 | BRD-K97752965 | HUH7 | 15 uM | 72 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |