CMap Candidate Details
Structure:
| CMap ID: | C03702 |
| Pert ID: | BRD-K59333713 |
| Compound Name: | niguldipine-(S)-(+) |
| Targets: | ADRA1A |
| MoA: | adrenergic receptor antagonist |
| SMILES: | COC(=O)C1=C(C)NC(C)=C([C@H]1c1cccc(c1)[N+]([O-])=O)C(=O)OCCCN1CCC(CC1)(c1ccccc1)c1ccccc1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 85005 | BRD-K59333713 | A375 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.33 | 1.17 | 0.92 |
| 85097 | BRD-K59333713 | A549 | 20 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 85197 | BRD-K59333713 | HA1E | 10 uM | 24 h | 0.27 | 1.13 | 0.29 | -0.32 | -1.07 | 0.78 |
| 85307 | BRD-K59333713 | HCC515 | 20 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 85408 | BRD-K59333713 | HEPG2 | 4 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 85509 | BRD-K59333713 | HT29 | 10 uM | 24 h | -0.2 | -0.83 | 0.0 | -0.27 | -0.92 | 0.33 |
| 85607 | BRD-K59333713 | MCF??7.00 | 4 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.21 | -0.72 | 0.04 |
| 85700 | BRD-K59333713 | PC3 | 20 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 99704 | BRD-K59333713 | U2OS | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |