CMap Candidate Details
Structure:
| CMap ID: | C03815 |
| Pert ID: | BRD-K24696047 |
| Compound Name: | NVP-AEW541 |
| Targets: | IGF1R|INSR |
| MoA: | IGF-1 inhibitor |
| SMILES: | Nc1ncnc2n(cc(-c3cccc(OCc4ccccc4)c3)c12)[C@@H]1C[C@H](CN2CCC2)C1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 96815 | BRD-K24696047 | A375 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 96890 | BRD-K24696047 | PC3 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.33 | 1.16 | 0.9 |