CMap Candidate Details
Structure:
| CMap ID: | C00384 |
| Pert ID: | BRD-K15164005 |
| Compound Name: | apoptosis-activator-II |
| Targets: | BCHE|CES1 |
| MoA: | carboxylesterase inhibitor |
| SMILES: | Clc1ccc(CN2C(=O)C(=O)c3ccccc23)cc1Cl |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 2840 | BRD-K15164005 | HA1E | 10 uM | 24 h | -0.25 | -1.06 | 0.25 | 0.0 | 0.0 | 0.0 |
| 3145 | BRD-K15164005 | HCC515 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 3596 | BRD-K15164005 | PC3 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.3 | -1.0 | 0.55 |
| 3728 | BRD-K15164005 | VCAP | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.22 | -0.75 | 0.07 |
| 39093 | BRD-K15164005 | A375 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.37 | -1.26 | 1.35 |
| 39300 | BRD-K15164005 | A549 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 39632 | BRD-K15164005 | ASC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 39948 | BRD-K15164005 | HEPG2 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.29 | -0.98 | 0.49 |
| 40230 | BRD-K15164005 | HT29 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.37 | -1.24 | 1.31 |
| 40592 | BRD-K15164005 | MCF??7.00 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 40756 | BRD-K15164005 | NEU | 10 uM | 24 h | -0.25 | -1.03 | 0.19 | 0.0 | 0.0 | 0.0 |
| 41056 | BRD-K15164005 | NPC | 10 uM | 24 h | -0.15 | -0.64 | 0.0 | -0.29 | -0.97 | 0.46 |
| 41385 | BRD-K15164005 | SKB | 10 uM | 24 h | -0.26 | -1.09 | 0.32 | 0.0 | 0.0 | 0.0 |
| 100129 | BRD-K15164005 | U2OS | 10 uM | 6 h | -0.24 | -0.99 | 0.14 | 0.0 | 0.0 | 0.0 |