CMap Candidate Details
Structure:
| CMap ID: | C03959 |
| Pert ID: | BRD-A33447119 |
| Compound Name: | oxfendazole |
| Targets: | |
| MoA: | anthelmintic agent |
| SMILES: | COC(=O)Nc1nc2ccc(cc2[nH]1)S(=O)c1ccccc1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 5513 | BRD-A33447119 | HCC515 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 6368 | BRD-A33447119 | VCAP | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 37479 | BRD-A33447119 | ASC | 10 uM | 24 h | 0.26 | 1.09 | 0.23 | -0.33 | -1.12 | 0.93 |
| 37807 | BRD-A33447119 | HEPG2 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 38144 | BRD-A33447119 | MCF??7.00 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 38329 | BRD-A33447119 | NPC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.34 | -1.15 | 1.07 |
| 38626 | BRD-A33447119 | PHH | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 38844 | BRD-A33447119 | SKB | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 91301 | BRD-A33447119 | HUH7 | 10 uM | 72 h | -0.26 | -1.1 | 0.34 | 0.0 | 0.0 | 0.0 |
| 120523 | BRD-A33447119 | A375 | 10 uM | 24 h | 0.21 | 0.88 | 0.02 | 0.3 | 1.06 | 0.58 |
| 120557 | BRD-A33447119 | A549 | 0.04 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.21 | 0.73 | 0.03 |
| 120597 | BRD-A33447119 | HA1E | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 120658 | BRD-A33447119 | HT29 | 0.04 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 120710 | BRD-A33447119 | JURKAT | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 120778 | BRD-A33447119 | PC3 | 0.125 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 120818 | BRD-A33447119 | YAPC | 0.04 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 129035 | BRD-A33447119 | HELA | 0.01 uM | 3 h | 0.0 | 0.0 | 0.0 | -0.26 | -0.88 | 0.25 |