CMap Candidate Details
Structure:
| CMap ID: | C03961 |
| Pert ID: | BRD-K52075715 |
| Compound Name: | oxibendazole |
| Targets: | TUBB|TUBB4B |
| MoA: | tubulin polymerization inhibitor |
| SMILES: | CCCOc1ccc2nc(NC(=O)OC)[nH]c2c1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 5462 | BRD-K52075715 | HA1E | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.3 | 1.07 | 0.62 |
| 5645 | BRD-K52075715 | HCC515 | 10 uM | 24 h | -0.3 | -1.27 | 0.74 | 0.0 | 0.0 | 0.0 |
| 5927 | BRD-K52075715 | HEPG2 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 6034 | BRD-K52075715 | HT29 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.23 | 0.8 | 0.08 |
| 6337 | BRD-K52075715 | VCAP | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 37170 | BRD-K52075715 | A375 | 10 uM | 6 h | -0.22 | -0.9 | 0.04 | -0.27 | -0.91 | 0.31 |
| 37295 | BRD-K52075715 | A549 | 10 uM | 24 h | -0.24 | -0.99 | 0.14 | 0.0 | 0.0 | 0.0 |
| 37686 | BRD-K52075715 | ASC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 38509 | BRD-K52075715 | NPC | 10 uM | 24 h | 0.22 | 0.93 | 0.05 | -0.45 | -1.5 | 15.35 |
| 38970 | BRD-K52075715 | SKB | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 51615 | BRD-K52075715 | MCF??7.00 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.23 | -0.78 | 0.09 |
| 51831 | BRD-K52075715 | PC3 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.33 | -1.11 | 0.9 |
| 91303 | BRD-K52075715 | HUH7 | 12.5 uM | 72 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |