CMap Candidate Details
Structure:
| CMap ID: | C03974 |
| Pert ID: | BRD-K59037100 |
| Compound Name: | oxybenzone |
| Targets: | LIPE |
| MoA: | lipase inhibitor |
| SMILES: | COc1ccc(C(=O)c2ccccc2)c(O)c1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 3381 | BRD-K59037100 | HCC515 | 10 uM | 6 h | -0.24 | -0.98 | 0.12 | 0.0 | 0.0 | 0.0 |
| 3974 | BRD-K59037100 | VCAP | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.3 | -1.01 | 0.56 |
| 44993 | BRD-K59037100 | ASC | 10 uM | 24 h | 0.26 | 1.08 | 0.21 | -0.31 | -1.04 | 0.67 |
| 45285 | BRD-K59037100 | HEPG2 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 46109 | BRD-K59037100 | NPC | 10 uM | 24 h | -0.22 | -0.93 | 0.07 | -0.19 | -0.63 | 0.0 |
| 46422 | BRD-K59037100 | PHH | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.29 | -0.99 | 0.5 |
| 46748 | BRD-K59037100 | SKB | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.3 | -0.99 | 0.51 |
| 123805 | BRD-K59037100 | A375 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.3 | 1.05 | 0.57 |
| 123845 | BRD-K59037100 | A549 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.24 | -0.82 | 0.15 |
| 123874 | BRD-K59037100 | HA1E | 1.11 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.27 | -0.91 | 0.3 |
| 123911 | BRD-K59037100 | HEK293 | 0.04 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.26 | -0.87 | 0.22 |
| 123950 | BRD-K59037100 | HELA | 1.11 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 124012 | BRD-K59037100 | JURKAT | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 124065 | BRD-K59037100 | MCF10A | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.33 | 1.17 | 0.93 |
| 124194 | BRD-K59037100 | THP1 | 0.125 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 124246 | BRD-K59037100 | YAPC | 0.04 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 132235 | BRD-K59037100 | HT29 | 0.01 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.35 | -1.18 | 1.15 |
| 132259 | BRD-K59037100 | MCF??7.00 | 0.08 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 132277 | BRD-K59037100 | MDAMB231 | 0.08 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.29 | -0.96 | 0.44 |
| 132303 | BRD-K59037100 | PC3 | 0.01 uM | 24 h | 0.21 | 0.88 | 0.01 | -0.18 | -0.6 | 0.0 |