CMap Candidate Details
Structure:
| CMap ID: | C03980 |
| Pert ID: | BRD-K16195444 |
| Compound Name: | oxymetazoline |
| Targets: | ADRA1A|ADRA1B|ADRA1D|ADRA2A|ADRA2B|ADRA2C|HTR1B|HTR1D|HTR2C |
| MoA: | adrenergic receptor agonist |
| SMILES: | Cc1cc(c(O)c(C)c1CC1=NCCN1)C(C)(C)C |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 2841 | BRD-K16195444 | HA1E | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 3336 | BRD-K16195444 | HCC515 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 3730 | BRD-K16195444 | VCAP | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.26 | -0.89 | 0.27 |
| 44877 | BRD-K16195444 | ASC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.31 | -1.06 | 0.73 |
| 45180 | BRD-K16195444 | HEPG2 | 10 uM | 6 h | -0.25 | -1.06 | 0.26 | -0.29 | -0.98 | 0.48 |
| 45994 | BRD-K16195444 | NPC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 46312 | BRD-K16195444 | PHH | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 46627 | BRD-K16195444 | SKB | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.25 | -0.83 | 0.16 |
| 91007 | BRD-K16195444 | HUH7 | 12.5 uM | 72 h | 0.0 | 0.0 | 0.0 | -0.29 | -0.98 | 0.48 |
| 100144 | BRD-K16195444 | U2OS | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.27 | 0.95 | 0.31 |
| 120234 | BRD-K16195444 | A375 | 0.125 uM | 24 h | -0.19 | -0.78 | 0.0 | 0.0 | 0.0 | 0.0 |
| 120269 | BRD-K16195444 | A549 | 0.125 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 120358 | BRD-K16195444 | HELA | 10 uM | 3 h | 0.27 | 1.12 | 0.26 | -0.26 | -0.89 | 0.27 |
| 120398 | BRD-K16195444 | MCF??7.00 | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 120463 | BRD-K16195444 | YAPC | 10 uM | 24 h | -0.19 | -0.78 | 0.0 | 0.25 | 0.87 | 0.17 |
| 128940 | BRD-K16195444 | HT29 | 0.74 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 128972 | BRD-K16195444 | PC3 | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.34 | -1.13 | 1.01 |