CMap Candidate Details
Structure:
| CMap ID: | C04046 |
| Pert ID: | BRD-A29289453 |
| Compound Name: | PCA-4248 |
| Targets: | PTAFR |
| MoA: | platelet activating factor receptor antagonist |
| SMILES: | COC(=O)C1=C(C)NC(C)=C(C1C)C(=O)OCCSc1ccccc1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 3095 | BRD-A29289453 | HCC515 | 10 uM | 24 h | -0.26 | -1.07 | 0.28 | 0.0 | 0.0 | 0.0 |
| 3433 | BRD-A29289453 | PC3 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 3922 | BRD-A29289453 | VCAP | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 44757 | BRD-A29289453 | ASC | 10 uM | 24 h | -0.23 | -0.97 | 0.11 | 0.0 | 0.0 | 0.0 |
| 45078 | BRD-A29289453 | HEPG2 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 45877 | BRD-A29289453 | NPC | 10 uM | 24 h | 0.2 | 0.84 | 0.0 | 0.28 | 0.99 | 0.42 |
| 46190 | BRD-A29289453 | PHH | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.32 | 1.13 | 0.84 |
| 46507 | BRD-A29289453 | SKB | 10 uM | 24 h | -0.32 | -1.32 | 0.82 | 0.0 | 0.0 | 0.0 |
| 119950 | BRD-A29289453 | A375 | 0.125 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 119992 | BRD-A29289453 | A549 | 0.37 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 120028 | BRD-A29289453 | HA1E | 10 uM | 24 h | 0.29 | 1.22 | 0.48 | -0.35 | -1.18 | 1.14 |
| 120055 | BRD-A29289453 | HELA | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.38 | -1.29 | 1.53 |
| 120109 | BRD-A29289453 | HT29 | 1.11 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.25 | -0.84 | 0.18 |
| 120151 | BRD-A29289453 | MCF??7.00 | 0.125 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 128874 | BRD-A29289453 | YAPC | 0.03 uM | 24 h | 0.28 | 1.16 | 0.35 | -0.28 | -0.93 | 0.35 |