CMap Candidate Details
Structure:
| CMap ID: | C04052 |
| Pert ID: | BRD-A89337244 |
| Compound Name: | PD-102807 |
| Targets: | CHRM4 |
| MoA: | acetylcholine receptor antagonist |
| SMILES: | CCOC(=O)c1c(C)[nH]c2ccc3OC4N(CCc5cc(OC)ccc45)Cc3c12 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 2977 | BRD-A89337244 | HA1E | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 3327 | BRD-A89337244 | HCC515 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.28 | 1.01 | 0.44 |
| 3457 | BRD-A89337244 | PC3 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.39 | -1.31 | 1.71 |
| 3709 | BRD-A89337244 | VCAP | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 44267 | BRD-A89337244 | A375 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 44498 | BRD-A89337244 | A549 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.27 | -0.9 | 0.28 |
| 44794 | BRD-A89337244 | ASC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 45115 | BRD-A89337244 | HEPG2 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 45386 | BRD-A89337244 | HT29 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.45 | 1.61 | 2.38 |
| 45625 | BRD-A89337244 | MCF??7.00 | 10 uM | 24 h | -0.2 | -0.82 | 0.0 | -0.29 | -0.96 | 0.44 |
| 45914 | BRD-A89337244 | NPC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 46231 | BRD-A89337244 | PHH | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 46545 | BRD-A89337244 | SKB | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |