CMap Candidate Details
Structure:
| CMap ID: | C04058 |
| Pert ID: | BRD-K48735772 |
| Compound Name: | PD-158780 |
| Targets: | EGFR |
| MoA: | EGFR inhibitor |
| SMILES: | CNc1cc2c(Nc3cccc(Br)c3)ncnc2cn1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 6763 | BRD-K48735772 | A375 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.36 | -1.22 | 1.24 |
| 7165 | BRD-K48735772 | A549 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 7452 | BRD-K48735772 | HA1E | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 7669 | BRD-K48735772 | HCC515 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.36 | 1.28 | 1.42 |
| 7875 | BRD-K48735772 | HT29 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 8191 | BRD-K48735772 | MCF??7.00 | 10 uM | 6 h | -0.22 | -0.91 | 0.05 | 0.29 | 1.02 | 0.47 |
| 8377 | BRD-K48735772 | PC3 | 10 uM | 24 h | -0.28 | -1.15 | 0.44 | 0.25 | 0.9 | 0.22 |
| 8822 | BRD-K48735772 | VCAP | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 90883 | BRD-K48735772 | MCF10A | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 99595 | BRD-K48735772 | U2OS | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |