CMap Candidate Details
Structure:
| CMap ID: | C04149 |
| Pert ID: | BRD-K40302533 |
| Compound Name: | PF-5274857 |
| Targets: | SMO |
| MoA: | smoothened receptor antagonist |
| SMILES: | Cc1cnc(c(C)c1)-c1cc(ncc1Cl)N1CCN(CC1)C(=O)CCS(C)(=O)=O |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 95508 | BRD-K40302533 | A549 | 10 uM | 48 h | 0.0 | 0.0 | 0.0 | 0.21 | 0.75 | 0.04 |
| 95582 | BRD-K40302533 | MCF??7.00 | 10 uM | 48 h | -0.24 | -1.01 | 0.17 | -0.32 | -1.09 | 0.83 |
| 95676 | BRD-K40302533 | U2OS | 10 uM | 48 h | 0.0 | 0.0 | 0.0 | 0.21 | 0.74 | 0.03 |
| 96549 | BRD-K40302533 | PC3 | 1.11 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 97033 | BRD-K40302533 | A375 | 10 uM | 24 h | 0.23 | 0.98 | 0.09 | 0.4 | 1.42 | 2.2 |