CMap Candidate Details
Structure:
| CMap ID: | C04237 |
| Pert ID: | BRD-K66874953 |
| Compound Name: | pifithrin-alpha |
| Targets: | TP53 |
| MoA: | TP53 inhibitor |
| SMILES: | Cc1ccc(cc1)C(=O)Cn1c2CCCCc2sc1=N |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 4462 | BRD-K66874953 | HCC515 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 8967 | BRD-K66874953 | A375 | 70 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.42 | -1.41 | 2.02 |
| 9221 | BRD-K66874953 | A549 | 70 uM | 6 h | 0.23 | 0.96 | 0.08 | -0.27 | -0.92 | 0.34 |
| 9476 | BRD-K66874953 | AGS | 70 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.23 | -0.77 | 0.08 |
| 9781 | BRD-K66874953 | H1299 | 70 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.21 | -0.71 | 0.03 |
| 9905 | BRD-K66874953 | HA1E | 70 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.33 | -1.12 | 0.95 |
| 10564 | BRD-K66874953 | HCT116 | 70 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.31 | -1.06 | 0.72 |
| 10997 | BRD-K66874953 | HT29 | 70 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.25 | -0.86 | 0.2 |
| 11162 | BRD-K66874953 | MCF??7.00 | 70 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 11541 | BRD-K66874953 | NCIH2073 | 70 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 11808 | BRD-K66874953 | NCIH508 | 70 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 12101 | BRD-K66874953 | NCIH596 | 70 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.26 | -0.87 | 0.23 |
| 12473 | BRD-K66874953 | PC3 | 70 uM | 24 h | -0.34 | -1.42 | 1.43 | -0.28 | -0.94 | 0.38 |
| 12841 | BRD-K66874953 | SW480 | 70 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.35 | -1.19 | 1.15 |
| 12987 | BRD-K66874953 | THP1 | 70 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.25 | -0.83 | 0.16 |
| 13326 | BRD-K66874953 | U937 | 70 uM | 6 h | 0.2 | 0.85 | 0.01 | 0.25 | 0.88 | 0.18 |
| 13655 | BRD-K66874953 | VCAP | 70 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 37715 | BRD-K66874953 | ASC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 37933 | BRD-K66874953 | HEPG2 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 38537 | BRD-K66874953 | NPC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 38990 | BRD-K66874953 | SKB | 10 uM | 24 h | -0.18 | -0.75 | 0.0 | 0.0 | 0.0 | 0.0 |
| 99355 | BRD-K66874953 | U2OS | 15 uM | 6 h | 0.23 | 0.97 | 0.08 | 0.0 | 0.0 | 0.0 |