CMap Candidate Details
Structure:
| CMap ID: | C04288 |
| Pert ID: | BRD-K01902415 |
| Compound Name: | pirinixic-acid |
| Targets: | PPARA |
| MoA: | PPAR receptor agonist |
| SMILES: | Cc1cccc(Nc2cc(Cl)nc(SCC(O)=O)n2)c1C |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 4182 | BRD-K01902415 | HA1E | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 4338 | BRD-K01902415 | HCC515 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.31 | -1.03 | 0.62 |
| 4634 | BRD-K01902415 | PC3 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 5020 | BRD-K01902415 | VCAP | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 44279 | BRD-K01902415 | A375 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 44657 | BRD-K01902415 | A549 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 44815 | BRD-K01902415 | ASC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 45634 | BRD-K01902415 | MCF??7.00 | 10 uM | 24 h | -0.21 | -0.86 | 0.02 | 0.0 | 0.0 | 0.0 |
| 46565 | BRD-K01902415 | SKB | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.36 | 1.26 | 1.29 |
| 52762 | BRD-K01902415 | HEPG2 | 20 uM | 24 h | 0.25 | 1.03 | 0.14 | 0.24 | 0.87 | 0.17 |
| 98740 | BRD-K01902415 | NPC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.35 | -1.19 | 1.15 |
| 98858 | BRD-K01902415 | NEU | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |