CMap Candidate Details
Structure:
| CMap ID: | C04296 |
| Pert ID: | BRD-K43978949 |
| Compound Name: | PIT |
| Targets: | P2RY1 |
| MoA: | purinergic receptor antagonist |
| SMILES: | [O-][N+]1=C(C(=O)c2ccccc12)c1ccccn1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 2884 | BRD-K43978949 | HA1E | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 3369 | BRD-K43978949 | HCC515 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 3506 | BRD-K43978949 | PC3 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.25 | -0.86 | 0.2 |
| 3962 | BRD-K43978949 | VCAP | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 44399 | BRD-K43978949 | A375 | 10 uM | 6 h | -0.24 | -0.98 | 0.12 | 0.0 | 0.0 | 0.0 |
| 44707 | BRD-K43978949 | A549 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.28 | 0.99 | 0.4 |
| 45259 | BRD-K43978949 | HEPG2 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 45528 | BRD-K43978949 | HT29 | 10 uM | 6 h | -0.23 | -0.96 | 0.1 | 0.0 | 0.0 | 0.0 |
| 45697 | BRD-K43978949 | MCF??7.00 | 10 uM | 24 h | -0.2 | -0.82 | 0.0 | -0.25 | -0.83 | 0.17 |
| 46080 | BRD-K43978949 | NPC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.26 | -0.88 | 0.24 |