CMap Candidate Details
Structure:
| CMap ID: | C04326 |
| Pert ID: | BRD-K28863208 |
| Compound Name: | PNU-282987 |
| Targets: | CHRNA7 |
| MoA: | cholinergic receptor agonist |
| SMILES: | Clc1ccc(cc1)C(=O)N[C@H]1CN2CCC1CC2 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 4211 | BRD-K28863208 | HA1E | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 4558 | BRD-K28863208 | HCC515 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 4794 | BRD-K28863208 | PC3 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 5065 | BRD-K28863208 | VCAP | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.39 | -1.32 | 1.71 |
| 37139 | BRD-K28863208 | A375 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 37375 | BRD-K28863208 | A549 | 10 uM | 6 h | 0.18 | 0.74 | 0.0 | 0.0 | 0.0 | 0.0 |
| 37627 | BRD-K28863208 | ASC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 37888 | BRD-K28863208 | HEPG2 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 38070 | BRD-K28863208 | HT29 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 38244 | BRD-K28863208 | MCF??7.00 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 38454 | BRD-K28863208 | NPC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 38703 | BRD-K28863208 | PHH | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 99805 | BRD-K28863208 | U2OS | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |