CMap Candidate Details
Structure:
| CMap ID: | C04377 |
| Pert ID: | BRD-K85883481 |
| Compound Name: | prednisone |
| Targets: | HSD11B1|NR3C1 |
| MoA: | glucocorticoid receptor agonist |
| SMILES: | C[C@]12CC(=O)[C@H]3[C@@H](CCC4=CC(=O)C=C[C@]34C)[C@@H]1CC[C@]2(O)C(=O)CO |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 52539 | BRD-K85883481 | A549 | 2.22 uM | 24 h | -0.21 | -0.88 | 0.03 | -0.32 | -1.08 | 0.79 |
| 52574 | BRD-K85883481 | HEPG2 | 6.66 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 91376 | BRD-K85883481 | HUH7 | 10 uM | 72 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |