CMap Candidate Details
Structure:
| CMap ID: | C00438 |
| Pert ID: | BRD-K63915849 |
| Compound Name: | AS-604850 |
| Targets: | PIK3CA|PIK3CG |
| MoA: | PI3K inhibitor |
| SMILES: | FC1(F)Oc2ccc(cc2O1)\C=C1/SC(=O)NC1=O |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 33532 | BRD-K63915849 | A375 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 33820 | BRD-K63915849 | A549 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.38 | 1.35 | 1.72 |
| 34142 | BRD-K63915849 | ASC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 34396 | BRD-K63915849 | HA1E | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 34655 | BRD-K63915849 | HCC515 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 34924 | BRD-K63915849 | HEPG2 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.37 | -1.25 | 1.35 |
| 35174 | BRD-K63915849 | HT29 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 35382 | BRD-K63915849 | MCF??7.00 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 35594 | BRD-K63915849 | NEU | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 35814 | BRD-K63915849 | NPC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 36094 | BRD-K63915849 | PC3 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.28 | -0.94 | 0.39 |
| 36304 | BRD-K63915849 | PHH | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 36602 | BRD-K63915849 | SKB | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.31 | 1.09 | 0.67 |
| 36846 | BRD-K63915849 | VCAP | 10 uM | 24 h | -0.33 | -1.38 | 1.08 | -0.24 | -0.82 | 0.15 |