CMap Candidate Details
Structure:
| CMap ID: | C04398 |
| Pert ID: | BRD-K24616672 |
| Compound Name: | procaine |
| Targets: | CHRNA2|GRIN3A|HTR3A|KCNMA1|KCNMB1|KCNMB2|KCNMB3|KCNMB4|KCNN1|KCNN2|KCNN3|KCNN4|MAOA|MAOB|RYR1|RYR2|SCN10A|SLC6A3 |
| MoA: | HMGCR inhibitor |
| SMILES: | CCN(CC)CCOC(=O)c1ccc(N)cc1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 120961 | BRD-K24616672 | HEK293 | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 121003 | BRD-K24616672 | HELA | 0.04 uM | 3 h | 0.21 | 0.87 | 0.01 | 0.0 | 0.0 | 0.0 |
| 121049 | BRD-K24616672 | MCF??7.00 | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 121117 | BRD-K24616672 | YAPC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 129099 | BRD-K24616672 | A375 | 2.22 uM | 24 h | 0.23 | 0.95 | 0.06 | 0.0 | 0.0 | 0.0 |
| 129119 | BRD-K24616672 | A549 | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.31 | 1.1 | 0.69 |
| 129139 | BRD-K24616672 | HA1E | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.25 | -0.84 | 0.18 |
| 129195 | BRD-K24616672 | HT29 | 0.03 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 129222 | BRD-K24616672 | PC3 | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |