CMap Candidate Details
Structure:
| CMap ID: | C00441 |
| Pert ID: | BRD-K27938825 |
| Compound Name: | ASA-404 |
| Targets: | |
| MoA: | angiogenesis inhibitor |
| SMILES: | Cc1ccc2c(oc3c(CC(O)=O)cccc3c2=O)c1C |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 119939 | BRD-K27938825 | A375 | 10 uM | 24 h | -0.24 | -1.01 | 0.16 | 0.0 | 0.0 | 0.0 |
| 119981 | BRD-K27938825 | A549 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.28 | -0.94 | 0.37 |
| 120021 | BRD-K27938825 | HA1E | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.27 | -0.92 | 0.34 |
| 120097 | BRD-K27938825 | HT29 | 1.11 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 120141 | BRD-K27938825 | MCF??7.00 | 1.11 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 120178 | BRD-K27938825 | PC3 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.24 | -0.79 | 0.11 |
| 128827 | BRD-K27938825 | HELA | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 128866 | BRD-K27938825 | YAPC | 0.08 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |