CMap Candidate Details
Structure:
| CMap ID: | C04410 |
| Pert ID: | BRD-A44863528 |
| Compound Name: | proglumide |
| Targets: | CCKAR|CCKBR |
| MoA: | CCK receptor antagonist |
| SMILES: | CCCN(CCC)C(=O)C(CCC(O)=O)NC(=O)c1ccccc1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 125229 | BRD-A44863528 | A375 | 0.04 uM | 24 h | -0.3 | -1.25 | 0.7 | 0.0 | 0.0 | 0.0 |
| 125252 | BRD-A44863528 | A549 | 0.04 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 125291 | BRD-A44863528 | HEK293 | 0.37 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 125344 | BRD-A44863528 | HELA | 0.37 uM | 24 h | -0.2 | -0.83 | 0.0 | 0.0 | 0.0 | 0.0 |
| 125366 | BRD-A44863528 | HT29 | 1.11 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 125388 | BRD-A44863528 | JURKAT | 1.11 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.38 | -1.29 | 1.53 |
| 125427 | BRD-A44863528 | MCF??7.00 | 0.37 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 125482 | BRD-A44863528 | PC3 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 125511 | BRD-A44863528 | THP1 | 0.125 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 125538 | BRD-A44863528 | YAPC | 0.04 uM | 24 h | 0.19 | 0.77 | 0.0 | 0.0 | 0.0 | 0.0 |
| 133379 | BRD-A44863528 | HA1E | 0.74 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.34 | -1.13 | 0.99 |
| 133502 | BRD-A44863528 | MCF10A | 0.03 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 133536 | BRD-A44863528 | MDAMB231 | 0.25 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.33 | -1.1 | 0.86 |