CMap Candidate Details
Structure:
| CMap ID: | C04428 |
| Pert ID: | BRD-K18250272 |
| Compound Name: | propoxycaine |
| Targets: | |
| MoA: | local anesthetic |
| SMILES: | CCCOc1cc(N)ccc1C(=O)OCCN(CC)CC |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 4202 | BRD-K18250272 | HA1E | 10 uM | 6 h | 0.34 | 1.41 | 1.03 | -0.25 | -0.84 | 0.18 |
| 4384 | BRD-K18250272 | HCC515 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.25 | -0.84 | 0.18 |
| 4661 | BRD-K18250272 | PC3 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 5050 | BRD-K18250272 | VCAP | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.24 | -0.81 | 0.13 |
| 39097 | BRD-K18250272 | A375 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 39639 | BRD-K18250272 | ASC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 39954 | BRD-K18250272 | HEPG2 | 10 uM | 6 h | -0.22 | -0.92 | 0.06 | 0.0 | 0.0 | 0.0 |
| 40235 | BRD-K18250272 | HT29 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 40762 | BRD-K18250272 | NEU | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 41063 | BRD-K18250272 | NPC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 41392 | BRD-K18250272 | SKB | 10 uM | 24 h | 0.28 | 1.18 | 0.39 | -0.25 | -0.84 | 0.18 |
| 52006 | BRD-K18250272 | MCF??7.00 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.23 | -0.76 | 0.07 |