CMap Candidate Details
Structure:
| CMap ID: | C04436 |
| Pert ID: | BRD-K48168960 |
| Compound Name: | propylthiouracil |
| Targets: | DIO1|TPO |
| MoA: | thyroid peroxidase inhibitor |
| SMILES: | CCCc1cc(=O)[nH]c(=S)[nH]1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 50016 | BRD-K48168960 | A549 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.4 | -1.36 | 2.02 |
| 50369 | BRD-K48168960 | HCC515 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.2 | -0.67 | 0.02 |
| 99588 | BRD-K48168960 | U2OS | 12 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 121572 | BRD-K48168960 | A375 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.31 | -1.04 | 0.68 |
| 121617 | BRD-K48168960 | HA1E | 0.37 uM | 24 h | -0.2 | -0.83 | 0.0 | 0.33 | 1.18 | 1.01 |
| 121649 | BRD-K48168960 | HELA | 1.11 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 121666 | BRD-K48168960 | HT29 | 0.125 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 129668 | BRD-K48168960 | MCF??7.00 | 0.74 uM | 24 h | -0.23 | -0.95 | 0.09 | 0.0 | 0.0 | 0.0 |
| 129705 | BRD-K48168960 | PC3 | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 129738 | BRD-K48168960 | YAPC | 0.74 uM | 24 h | -0.27 | -1.14 | 0.42 | 0.0 | 0.0 | 0.0 |