CMap Candidate Details
Structure:
| CMap ID: | C04498 |
| Pert ID: | BRD-K11663430 |
| Compound Name: | pyroxamide |
| Targets: | HDAC1 |
| MoA: | HDAC inhibitor |
| SMILES: | ONC(=O)CCCCCCC(=O)Nc1cccnc1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 30166 | BRD-K11663430 | A549 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.24 | 0.85 | 0.14 |
| 30365 | BRD-K11663430 | ASC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.39 | -1.3 | 1.62 |
| 30686 | BRD-K11663430 | HA1E | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.26 | 0.91 | 0.23 |
| 30968 | BRD-K11663430 | HCC515 | 10 uM | 6 h | 0.22 | 0.91 | 0.03 | 0.0 | 0.0 | 0.0 |
| 31271 | BRD-K11663430 | HEPG2 | 10 uM | 6 h | -0.24 | -1.0 | 0.15 | 0.0 | 0.0 | 0.0 |
| 31748 | BRD-K11663430 | HT29 | 10 uM | 6 h | -0.21 | -0.85 | 0.01 | 0.0 | 0.0 | 0.0 |
| 31837 | BRD-K11663430 | MCF??7.00 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 32137 | BRD-K11663430 | NEU | 10 uM | 24 h | -0.26 | -1.07 | 0.27 | -0.29 | -0.98 | 0.47 |
| 32356 | BRD-K11663430 | NPC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 32947 | BRD-K11663430 | SKB | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 33429 | BRD-K11663430 | VCAP | 10 uM | 6 h | -0.22 | -0.9 | 0.04 | 0.0 | 0.0 | 0.0 |
| 96576 | BRD-K11663430 | A375 | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.24 | -0.81 | 0.14 |
| 96647 | BRD-K11663430 | PC3 | 3.33 uM | 24 h | -0.2 | -0.85 | 0.01 | 0.0 | 0.0 | 0.0 |
| 97304 | BRD-K11663430 | HAP1 | 0.66 uM | 24 h | -0.29 | -1.22 | 0.61 | 0.0 | 0.0 | 0.0 |