CMap Candidate Details
Structure:
| CMap ID: | C04516 |
| Pert ID: | BRD-A59303141 |
| Compound Name: | quinethazone |
| Targets: | CA1|CA2|SLC12A1|SLC12A2|SLC12A3 |
| MoA: | thiazide diuretic |
| SMILES: | CCC1NC(=O)c2cc(c(Cl)cc2N1)S(N)(=O)=O |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 6663 | BRD-A59303141 | A375 | 10 uM | 24 h | -0.24 | -1.0 | 0.15 | 0.0 | 0.0 | 0.0 |
| 7093 | BRD-A59303141 | A549 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 7564 | BRD-A59303141 | HCC515 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 7959 | BRD-A59303141 | HT29 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.28 | -0.96 | 0.43 |
| 8315 | BRD-A59303141 | PC3 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 8598 | BRD-A59303141 | VCAP | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 52100 | BRD-A59303141 | MCF??7.00 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 100243 | BRD-A59303141 | U2OS | 6.66 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |