CMap Candidate Details
Structure:
| CMap ID: | C04562 |
| Pert ID: | BRD-K85751432 |
| Compound Name: | refametinib |
| Targets: | MAP2K1|MAP2K2 |
| MoA: | MEK inhibitor |
| SMILES: | COc1cc(F)c(F)c(Nc2ccc(I)cc2F)c1NS(=O)(=O)C1(C[C@H](O)CO)CC1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 95349 | BRD-K85751432 | MCF??7.00 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 95425 | BRD-K85751432 | U2OS | 10 uM | 48 h | 0.0 | 0.0 | 0.0 | 0.26 | 0.91 | 0.23 |
| 125572 | BRD-K85751432 | A375 | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.28 | -0.95 | 0.41 |
| 125643 | BRD-K85751432 | HEK293 | 0.04 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 125692 | BRD-K85751432 | HT29 | 0.37 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.35 | 1.25 | 1.29 |
| 125721 | BRD-K85751432 | HUVEC | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 125867 | BRD-K85751432 | PC3 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 125920 | BRD-K85751432 | YAPC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.36 | 1.26 | 1.29 |
| 133660 | BRD-K85751432 | A549 | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.37 | 1.3 | 1.59 |
| 133692 | BRD-K85751432 | HA1E | 0.25 uM | 24 h | 0.29 | 1.2 | 0.42 | 0.22 | 0.79 | 0.07 |
| 133756 | BRD-K85751432 | HELA | 2.22 uM | 24 h | 0.24 | 1.01 | 0.12 | 0.37 | 1.31 | 1.59 |
| 133821 | BRD-K85751432 | JURKAT | 2.22 uM | 24 h | 0.22 | 0.91 | 0.03 | -0.28 | -0.93 | 0.35 |
| 133849 | BRD-K85751432 | MCF10A | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 133905 | BRD-K85751432 | MDAMB231 | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 133969 | BRD-K85751432 | THP1 | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.25 | -0.84 | 0.18 |