CMap Candidate Details
Structure:
| CMap ID: | C04650 |
| Pert ID: | BRD-A53134341 |
| Compound Name: | Ro-106-9920 |
| Targets: | |
| MoA: | NFkB pathway inhibitor |
| SMILES: | O=S(c1ccccc1)c1ccc2nnnn2n1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 84155 | BRD-A53134341 | A375 | 10 uM | 24 h | -0.24 | -1.01 | 0.16 | -0.49 | -1.66 | 15.65 |
| 84245 | BRD-A53134341 | A549 | 20 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.32 | -1.08 | 0.79 |
| 84331 | BRD-A53134341 | HA1E | 4 uM | 24 h | 0.24 | 1.01 | 0.12 | -0.29 | -0.99 | 0.5 |
| 84439 | BRD-A53134341 | HCC515 | 4 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 84549 | BRD-A53134341 | HEPG2 | 10 uM | 24 h | -0.22 | -0.93 | 0.07 | -0.38 | -1.28 | 1.45 |
| 84659 | BRD-A53134341 | HT29 | 20 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 84761 | BRD-A53134341 | MCF??7.00 | 20 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 84859 | BRD-A53134341 | PC3 | 20 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 100213 | BRD-A53134341 | U2OS | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |