CMap Candidate Details
Structure:
| CMap ID: | C04691 |
| Pert ID: | BRD-K91111634 |
| Compound Name: | rotigotine |
| Targets: | ADRA2B|DRD1|DRD2|DRD3|DRD4|DRD5|HTR1A |
| MoA: | dopamine receptor agonist |
| SMILES: | CCCN(CCc1cccs1)[C@H]1CCc2c(O)cccc2C1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 127743 | BRD-K91111634 | A375 | 0.125 uM | 24 h | -0.21 | -0.87 | 0.02 | -0.24 | -0.82 | 0.15 |
| 127787 | BRD-K91111634 | A549 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 127823 | BRD-K91111634 | HA1E | 1.11 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 127867 | BRD-K91111634 | HEK293 | 0.04 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 127941 | BRD-K91111634 | HUVEC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 127994 | BRD-K91111634 | MCF10A | 3.33 uM | 24 h | -0.18 | -0.77 | 0.0 | 0.0 | 0.0 | 0.0 |
| 128078 | BRD-K91111634 | YAPC | 1.11 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.29 | -0.98 | 0.48 |
| 135568 | BRD-K91111634 | HELA | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 135613 | BRD-K91111634 | HT29 | 0.74 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 135659 | BRD-K91111634 | JURKAT | 0.08 uM | 24 h | 0.23 | 0.96 | 0.08 | -0.27 | -0.92 | 0.31 |
| 135696 | BRD-K91111634 | MCF??7.00 | 2.22 uM | 24 h | 0.26 | 1.09 | 0.23 | -0.31 | -1.04 | 0.66 |
| 135719 | BRD-K91111634 | PC3 | 0.74 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |