CMap Candidate Details
Structure:
| CMap ID: | C00047 |
| Pert ID: | BRD-A49544621 |
| Compound Name: | AC-7954-(+/-) |
| Targets: | UTS2R |
| MoA: | urotensin receptor agonist |
| SMILES: | CN(C)CCC1(Cc2ccccc2C(=O)O1)c1ccc(Cl)cc1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 100192 | BRD-A49544621 | U2OS | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |