CMap Candidate Details
Structure:
| CMap ID: | C04748 |
| Pert ID: | BRD-K60005752 |
| Compound Name: | S-111 |
| Targets: | PARP1 |
| MoA: | PARP inhibitor |
| SMILES: | CC(C)=CCC[C@](C)(O)[C@H]1CC[C@]2(C)[C@@H]1[C@H](O)C[C@@H]1[C@@]3(C)CC[C@H](O)C(C)(C)[C@@H]3CC[C@@]21C |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 90856 | BRD-K60005752 | MCF10A | 3.33 uM | 12 h | 0.25 | 1.04 | 0.15 | -0.29 | -0.96 | 0.44 |
| 96466 | BRD-K60005752 | A375 | 10 uM | 24 h | 0.2 | 0.85 | 0.01 | 0.0 | 0.0 | 0.0 |
| 96533 | BRD-K60005752 | PC3 | 1.11 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |