CMap Candidate Details
Structure:
| CMap ID: | C04778 |
| Pert ID: | BRD-K35781423 |
| Compound Name: | SANT-2 |
| Targets: | SHH|SMO |
| MoA: | smoothened receptor antagonist |
| SMILES: | CCOc1cc(cc(OCC)c1OCC)C(=O)Nc1ccc(Cl)c(c1)-c1nc2ccccc2[nH]1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 90594 | BRD-K35781423 | HCT116 | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.43 | -1.46 | 15.35 |
| 90684 | BRD-K35781423 | MCF10A | 10 uM | 24 h | 0.29 | 1.2 | 0.43 | -0.35 | -1.17 | 1.12 |
| 96600 | BRD-K35781423 | A375 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 96672 | BRD-K35781423 | PC3 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.35 | -1.17 | 1.12 |
| 97984 | BRD-K35781423 | HA1E | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 98017 | BRD-K35781423 | MCF??7.00 | 10 uM | 24 h | 0.2 | 0.85 | 0.01 | -0.41 | -1.38 | 2.02 |
| 98059 | BRD-K35781423 | P1A82 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.29 | -0.97 | 0.46 |