CMap Candidate Details
Structure:
| CMap ID: | C04800 |
| Pert ID: | BRD-A22707317 |
| Compound Name: | SB-205384 |
| Targets: | GABRA3|GABRA5|GABRA6 |
| MoA: | GABA receptor modulator |
| SMILES: | CC#CCOC(=O)c1c(C)nc2sc3CC(O)CCc3c2c1N |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 1486 | BRD-A22707317 | HA1E | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.26 | 0.92 | 0.25 |
| 1815 | BRD-A22707317 | HCC515 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.27 | 0.95 | 0.32 |
| 2594 | BRD-A22707317 | VCAP | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 42002 | BRD-A22707317 | A549 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.39 | -1.33 | 1.72 |
| 42186 | BRD-A22707317 | ASC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 42531 | BRD-A22707317 | HEPG2 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 42839 | BRD-A22707317 | HT29 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 43116 | BRD-A22707317 | MCF??7.00 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 43386 | BRD-A22707317 | NPC | 10 uM | 24 h | -0.2 | -0.84 | 0.01 | -0.27 | -0.9 | 0.28 |
| 97172 | BRD-A22707317 | A375 | 10 uM | 24 h | 0.21 | 0.89 | 0.02 | 0.0 | 0.0 | 0.0 |
| 97234 | BRD-A22707317 | PC3 | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.23 | 0.8 | 0.08 |