CMap Candidate Details
Structure:
| CMap ID: | C04892 |
| Pert ID: | BRD-K21361524 |
| Compound Name: | selinexor |
| Targets: | XPO1 |
| MoA: | exportin antagonist |
| SMILES: | FC(F)(F)c1cc(cc(c1)C(F)(F)F)-c1ncn(\C=C/C(=O)NNc2cnccn2)n1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 120858 | BRD-K21361524 | A375 | 0.37 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.39 | -1.31 | 1.71 |
| 120904 | BRD-K21361524 | HA1E | 0.37 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.39 | -1.32 | 1.71 |
| 120941 | BRD-K21361524 | HEK293 | 3.33 uM | 24 h | -0.31 | -1.3 | 0.81 | -0.27 | -0.91 | 0.31 |
| 120998 | BRD-K21361524 | HELA | 1.11 uM | 3 h | -0.27 | -1.13 | 0.4 | -0.39 | -1.32 | 1.71 |
| 121033 | BRD-K21361524 | MCF??7.00 | 1.11 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.31 | -1.03 | 0.63 |
| 121099 | BRD-K21361524 | YAPC | 1.11 uM | 24 h | 0.18 | 0.77 | 0.0 | 0.0 | 0.0 | 0.0 |
| 129109 | BRD-K21361524 | A549 | 0.25 uM | 24 h | -0.3 | -1.25 | 0.69 | 0.0 | 0.0 | 0.0 |
| 129185 | BRD-K21361524 | HT29 | 0.74 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 129216 | BRD-K21361524 | PC3 | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.4 | -1.35 | 2.01 |