CMap Candidate Details
Structure:
| CMap ID: | C05028 |
| Pert ID: | BRD-K07612980 |
| Compound Name: | sparfloxacin |
| Targets: | TOP2A |
| MoA: | bacterial DNA gyrase inhibitor |
| SMILES: | C[C@H]1CN(C[C@@H](C)N1)c1c(F)c(N)c2c(c1F)n(cc(C(O)=O)c2=O)C1CC1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 52118 | BRD-K07612980 | MCF??7.00 | 10 uM | 6 h | -0.23 | -0.94 | 0.08 | 0.0 | 0.0 | 0.0 |
| 52264 | BRD-K07612980 | PC3 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.32 | -1.06 | 0.74 |
| 91457 | BRD-K07612980 | HUH7 | 8 uM | 72 h | 0.31 | 1.3 | 0.72 | 0.0 | 0.0 | 0.0 |