CMap Candidate Details
Structure:
| CMap ID: | C00515 |
| Pert ID: | BRD-K32821942 |
| Compound Name: | azathioprine |
| Targets: | HPRT1|IMPDH1|PPAT |
| MoA: | dehydrogenase inhibitor |
| SMILES: | Cn1cnc(c1Sc1[nH]cnc2ncnc12)[N+]([O-])=O |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 1207 | BRD-K32821942 | PC3 | 10 uM | 24 h | 0.25 | 1.06 | 0.19 | 0.0 | 0.0 | 0.0 |
| 1255 | BRD-K32821942 | A549 | 10 uM | 48 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 1361 | BRD-K32821942 | U2OS | 10 uM | 48 h | 0.0 | 0.0 | 0.0 | -0.26 | -0.89 | 0.27 |
| 13793 | BRD-K32821942 | A375 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 14445 | BRD-K32821942 | HA1E | 10 uM | 24 h | 0.32 | 1.32 | 0.79 | 0.0 | 0.0 | 0.0 |
| 14802 | BRD-K32821942 | HCC515 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 15038 | BRD-K32821942 | HT29 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.33 | -1.12 | 0.96 |
| 51142 | BRD-K32821942 | VCAP | 10 uM | 6 h | 0.22 | 0.9 | 0.02 | 0.0 | 0.0 | 0.0 |
| 120619 | BRD-K32821942 | HELA | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.3 | -1.02 | 0.62 |
| 120708 | BRD-K32821942 | JURKAT | 0.125 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 120752 | BRD-K32821942 | MCF??7.00 | 10 uM | 24 h | -0.23 | -0.97 | 0.11 | 0.0 | 0.0 | 0.0 |
| 120815 | BRD-K32821942 | YAPC | 0.04 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |