CMap Candidate Details
Structure:
| CMap ID: | C00053 |
| Pert ID: | BRD-K68633617 |
| Compound Name: | ACDPP |
| Targets: | GRM5 |
| MoA: | glutamate receptor antagonist |
| SMILES: | CN(C)c1nc(N)c(nc1Cl)C(=O)Nc1cccnc1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 88102 | BRD-K68633617 | VCAP | 30 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.24 | 0.87 | 0.17 |
| 99393 | BRD-K68633617 | U2OS | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |