CMap Candidate Details
Structure:
| CMap ID: | C00544 |
| Pert ID: | BRD-K69932463 |
| Compound Name: | AZD8055 |
| Targets: | MTOR |
| MoA: | mTOR inhibitor |
| SMILES: | COc1ccc(cc1CO)-c1ccc2c(nc(nc2n1)N1CCOC[C@@H]1C)N1CCOC[C@@H]1C |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 1362 | BRD-K69932463 | U2OS | 10 uM | 48 h | 0.0 | 0.0 | 0.0 | -0.35 | -1.17 | 1.11 |
| 1434 | BRD-K69932463 | NPC | 0.3 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.19 | -0.63 | 0.01 |
| 9023 | BRD-K69932463 | A375 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 9491 | BRD-K69932463 | AGS | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.29 | 1.02 | 0.48 |
| 9795 | BRD-K69932463 | H1299 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.27 | 0.97 | 0.35 |
| 10075 | BRD-K69932463 | HA1E | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 10257 | BRD-K69932463 | HCC515 | 10 uM | 6 h | -0.21 | -0.88 | 0.03 | 0.0 | 0.0 | 0.0 |
| 10834 | BRD-K69932463 | HEPG2 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 11007 | BRD-K69932463 | HT29 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 11556 | BRD-K69932463 | NCIH2073 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 11821 | BRD-K69932463 | NCIH508 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 12113 | BRD-K69932463 | NCIH596 | 10 uM | 6 h | -0.29 | -1.2 | 0.57 | 0.21 | 0.74 | 0.04 |
| 12623 | BRD-K69932463 | PC3 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.27 | -0.92 | 0.33 |
| 12852 | BRD-K69932463 | SW480 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 13341 | BRD-K69932463 | U937 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 13498 | BRD-K69932463 | VCAP | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 91551 | BRD-K69932463 | BT20 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 91712 | BRD-K69932463 | MDAMB231 | 2.22 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 92424 | BRD-K69932463 | A549 | 0.12 uM | 24 h | -0.24 | -0.98 | 0.12 | -0.26 | -0.87 | 0.24 |
| 92519 | BRD-K69932463 | HME1 | 1.11 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.28 | -0.96 | 0.42 |
| 92598 | BRD-K69932463 | HS578T | 0.12 uM | 3 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 92647 | BRD-K69932463 | LNCAP | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.24 | -0.82 | 0.15 |
| 92719 | BRD-K69932463 | MCF10A | 1.11 uM | 3 h | -0.31 | -1.29 | 0.79 | 0.24 | 0.86 | 0.15 |
| 92756 | BRD-K69932463 | MCF??7.00 | 10 uM | 3 h | 0.22 | 0.93 | 0.05 | -0.41 | -1.39 | 2.02 |
| 92843 | BRD-K69932463 | SKBR3 | 1.11 uM | 3 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 96035 | BRD-K69932463 | PHH | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.31 | 1.09 | 0.67 |