CMap Candidate Details
Structure:
| CMap ID: | C00630 |
| Pert ID: | BRD-K36864847 |
| Compound Name: | BD-1047 |
| Targets: | SIGMAR1 |
| MoA: | adrenergic receptor antagonist |
| SMILES: | CN(C)CCN(C)CCc1ccc(Cl)c(Cl)c1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 2874 | BRD-K36864847 | HA1E | 10 uM | 24 h | 0.2 | 0.84 | 0.0 | 0.0 | 0.0 | 0.0 |
| 3360 | BRD-K36864847 | HCC515 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 3617 | BRD-K36864847 | PC3 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 3779 | BRD-K36864847 | VCAP | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 44380 | BRD-K36864847 | A375 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 44578 | BRD-K36864847 | A549 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.37 | 1.31 | 1.59 |
| 44942 | BRD-K36864847 | ASC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.29 | 1.02 | 0.49 |
| 45240 | BRD-K36864847 | HEPG2 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 45510 | BRD-K36864847 | HT29 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 45689 | BRD-K36864847 | MCF??7.00 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 46061 | BRD-K36864847 | NPC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 46377 | BRD-K36864847 | PHH | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 46697 | BRD-K36864847 | SKB | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |