CMap Candidate Details
                      
                      Structure:
                         
                      
                  
                  | CMap ID: | C00723 | 
| Pert ID: | BRD-K29415052 | 
| Compound Name: | BGT226 | 
| Targets: | MTOR|PIK3CA|PIK3CB|PIK3CG | 
| MoA: | PI3K inhibitor | 
| SMILES: | COc1ccc(cn1)-c1ccc2ncc3n(C)c(=O)n(-c4ccc(N5CCNCC5)c(c4)C(F)(F)F)c3c2c1 | 
| InchiKey: | |
| Compound Aliases: | 
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) | 
|---|---|---|---|---|---|---|---|---|---|---|
| 92879 | BRD-K29415052 | A375 | 0.37 uM | 24 h | 0.27 | 1.14 | 0.32 | -0.21 | -0.71 | 0.03 | 
| 92906 | BRD-K29415052 | A549 | 0.12 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.25 | -0.85 | 0.19 | 
| 92962 | BRD-K29415052 | ASC | 10 uM | 24 h | 0.25 | 1.06 | 0.18 | 0.0 | 0.0 | 0.0 | 
| 93017 | BRD-K29415052 | CD34 | 0.12 uM | 24 h | 0.3 | 1.25 | 0.56 | -0.31 | -1.03 | 0.65 | 
| 93054 | BRD-K29415052 | HA1E | 1.11 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 
| 93103 | BRD-K29415052 | HEK293 | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.27 | -0.9 | 0.28 | 
| 93144 | BRD-K29415052 | HELA | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 
| 93186 | BRD-K29415052 | HEPG2 | 0.04 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 
| 93243 | BRD-K29415052 | HUVEC | 1.11 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 
| 93294 | BRD-K29415052 | JURKAT | 0.37 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 
| 93330 | BRD-K29415052 | MCF10A | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.25 | -0.86 | 0.21 | 
| 93372 | BRD-K29415052 | MDAMB231 | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.29 | -0.97 | 0.46 | 
| 93431 | BRD-K29415052 | NPC | 0.04 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.43 | -1.44 | 15.35 | 
| 93461 | BRD-K29415052 | PC3 | 0.04 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 
| 93498 | BRD-K29415052 | SKL | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.26 | -0.88 | 0.25 | 
| 93558 | BRD-K29415052 | THP1 | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.25 | -0.84 | 0.18 | 
| 93599 | BRD-K29415052 | YAPC | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 
 
    