CMap Candidate Details
Structure:
| CMap ID: | C00081 |
| Pert ID: | BRD-A29520968 |
| Compound Name: | acifran |
| Targets: | HCAR2|HCAR3 |
| MoA: | cholesterol inhibitor |
| SMILES: | CC1(OC(=CC1=O)C(O)=O)c1ccccc1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 121894 | BRD-A29520968 | A375 | 0.04 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 122008 | BRD-A29520968 | HT29 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 122046 | BRD-A29520968 | HUVEC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 122164 | BRD-A29520968 | PC3 | 0.125 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 130201 | BRD-A29520968 | A549 | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 130225 | BRD-A29520968 | HA1E | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 130256 | BRD-A29520968 | HEK293 | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 130287 | BRD-A29520968 | HELA | 0.01 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 130347 | BRD-A29520968 | JURKAT | 0.74 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.28 | -0.94 | 0.37 |
| 130396 | BRD-A29520968 | MCF10A | 0.03 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 130431 | BRD-A29520968 | MCF??7.00 | 0.03 uM | 24 h | -0.21 | -0.86 | 0.01 | 0.0 | 0.0 | 0.0 |
| 130448 | BRD-A29520968 | MDAMB231 | 0.03 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 130494 | BRD-A29520968 | THP1 | 0.03 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 130519 | BRD-A29520968 | YAPC | 0.25 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |