CMap Candidate Details
                      
                      Structure:
                         
                      
                  
                  | CMap ID: | C00812 | 
| Pert ID: | BRD-A15435692 | 
| Compound Name: | BMY-14802 | 
| Targets: | HTR1A | 
| MoA: | sigma receptor antagonist | 
| SMILES: | OC(CCCN1CCN(CC1)c1ncc(F)cn1)c1ccc(F)cc1 | 
| InchiKey: | |
| Compound Aliases: | 
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) | 
|---|---|---|---|---|---|---|---|---|---|---|
| 1811 | BRD-A15435692 | HCC515 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 
| 2590 | BRD-A15435692 | VCAP | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 
| 42178 | BRD-A15435692 | ASC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.32 | -1.07 | 0.77 | 
| 42523 | BRD-A15435692 | HEPG2 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 
| 43379 | BRD-A15435692 | NPC | 10 uM | 24 h | -0.33 | -1.39 | 1.14 | -0.41 | -1.37 | 2.02 | 
| 43695 | BRD-A15435692 | PHH | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.27 | -0.92 | 0.33 | 
| 122276 | BRD-A15435692 | A375 | 0.125 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 
| 122341 | BRD-A15435692 | HELA | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.26 | 0.93 | 0.28 | 
| 122429 | BRD-A15435692 | MDAMB231 | 1.11 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 
| 122502 | BRD-A15435692 | THP1 | 0.04 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 
| 130575 | BRD-A15435692 | A549 | 0.08 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 
| 130606 | BRD-A15435692 | HA1E | 0.03 uM | 24 h | -0.21 | -0.87 | 0.02 | -0.35 | -1.17 | 1.14 | 
| 130646 | BRD-A15435692 | HEK293 | 0.01 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 
| 130729 | BRD-A15435692 | HT29 | 0.25 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.19 | 0.67 | 0.01 | 
| 130752 | BRD-A15435692 | MCF10A | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 
| 130770 | BRD-A15435692 | MCF??7.00 | 0.08 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 
| 130823 | BRD-A15435692 | PC3 | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 
| 130851 | BRD-A15435692 | YAPC | 0.01 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 
 
    