CMap Candidate Details
Structure:
| CMap ID: | C00870 |
| Pert ID: | BRD-K79095980 |
| Compound Name: | broxuridine |
| Targets: | |
| MoA: | antimetabolite |
| SMILES: | OC[C@H]1O[C@H](C[C@@H]1O)n1cc(Br)c(=O)[nH]c1=O |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 127368 | BRD-K79095980 | A375 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 127403 | BRD-K79095980 | A549 | 10 uM | 24 h | 0.24 | 1.0 | 0.1 | 0.0 | 0.0 | 0.0 |
| 127445 | BRD-K79095980 | HA1E | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 127535 | BRD-K79095980 | JURKAT | 10 uM | 24 h | -0.28 | -1.17 | 0.48 | 0.0 | 0.0 | 0.0 |
| 127584 | BRD-K79095980 | MCF??7.00 | 10 uM | 24 h | -0.26 | -1.08 | 0.3 | 0.0 | 0.0 | 0.0 |
| 127623 | BRD-K79095980 | PC3 | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 127660 | BRD-K79095980 | THP1 | 10 uM | 24 h | -0.23 | -0.97 | 0.1 | -0.31 | -1.05 | 0.68 |
| 127708 | BRD-K79095980 | YAPC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.27 | -0.9 | 0.29 |
| 135380 | BRD-K79095980 | HELA | 0.01 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 135418 | BRD-K79095980 | HT29 | 0.08 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.31 | -1.03 | 0.64 |
| 135449 | BRD-K79095980 | MCF10A | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.28 | -0.95 | 0.42 |