CMap Candidate Details
Structure:
| CMap ID: | C00886 |
| Pert ID: | BRD-K24697665 |
| Compound Name: | bucillamine |
| Targets: | |
| MoA: | immunosuppressant |
| SMILES: | CC(C)(S)C(=O)N[C@@H](CS)C(O)=O |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|