CMap Candidate Details
Structure:
| CMap ID: | C00901 |
| Pert ID: | BRD-A05186015 |
| Compound Name: | bupropion |
| Targets: | CHRNA3|SLC6A2|SLC6A3 |
| MoA: | dopamine uptake inhibitor |
| SMILES: | CC(NC(C)(C)C)C(=O)c1cccc(Cl)c1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 5489 | BRD-A05186015 | HCC515 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.26 | -0.89 | 0.27 |
| 5816 | BRD-A05186015 | HEPG2 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 6447 | BRD-A05186015 | VCAP | 10 uM | 6 h | 0.23 | 0.96 | 0.08 | 0.3 | 1.05 | 0.57 |
| 37432 | BRD-A05186015 | ASC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.36 | -1.21 | 1.24 |
| 38286 | BRD-A05186015 | NPC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.4 | -1.34 | 1.85 |
| 91018 | BRD-A05186015 | HUH7 | 15 uM | 72 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 122674 | BRD-A05186015 | HT29 | 3.33 uM | 24 h | 0.23 | 0.97 | 0.08 | -0.25 | -0.84 | 0.18 |
| 122707 | BRD-A05186015 | MCF10A | 0.37 uM | 24 h | -0.23 | -0.97 | 0.11 | 0.2 | 0.7 | 0.02 |
| 130862 | BRD-A05186015 | A375 | 2.22 uM | 24 h | 0.25 | 1.06 | 0.18 | 0.0 | 0.0 | 0.0 |
| 130881 | BRD-A05186015 | A549 | 0.25 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 130907 | BRD-A05186015 | HA1E | 0.74 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.23 | -0.77 | 0.08 |
| 130929 | BRD-A05186015 | HEK293 | 0.08 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.27 | -0.91 | 0.31 |
| 130957 | BRD-A05186015 | HELA | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 131029 | BRD-A05186015 | HUVEC | 0.08 uM | 24 h | -0.25 | -1.05 | 0.22 | 0.0 | 0.0 | 0.0 |
| 131078 | BRD-A05186015 | MCF??7.00 | 2.22 uM | 24 h | -0.17 | -0.7 | 0.0 | 0.28 | 1.0 | 0.42 |
| 131111 | BRD-A05186015 | MDAMB231 | 0.08 uM | 24 h | -0.21 | -0.89 | 0.03 | -0.31 | -1.04 | 0.68 |
| 131142 | BRD-A05186015 | PC3 | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 131176 | BRD-A05186015 | YAPC | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |