CMap Candidate Details
Structure:
| CMap ID: | C00907 |
| Pert ID: | BRD-K23082237 |
| Compound Name: | butaclamol |
| Targets: | DRD1|DRD2|DRD3|DRD4|DRD5|HTR1A|HTR2A |
| MoA: | dopamine receptor antagonist |
| SMILES: | CC(C)(C)[C@@]1(O)CCN2C[C@@H]3c4ccccc4CCc4cccc([C@H]2C1)c34 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 121374 | BRD-K23082237 | A375 | 0.04 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.33 | 1.16 | 0.9 |
| 121421 | BRD-K23082237 | HELA | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.32 | 1.12 | 0.77 |
| 121487 | BRD-K23082237 | PC3 | 10 uM | 24 h | -0.29 | -1.22 | 0.61 | 0.0 | 0.0 | 0.0 |
| 121535 | BRD-K23082237 | YAPC | 10 uM | 24 h | -0.24 | -1.01 | 0.16 | 0.0 | 0.0 | 0.0 |
| 129450 | BRD-K23082237 | HA1E | 0.03 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 129503 | BRD-K23082237 | HT29 | 0.03 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 129534 | BRD-K23082237 | MCF??7.00 | 0.08 uM | 24 h | 0.23 | 0.98 | 0.09 | 0.0 | 0.0 | 0.0 |