CMap Candidate Details
Structure:
| CMap ID: | C00948 |
| Pert ID: | BRD-K96188950 |
| Compound Name: | caffeic-acid-phenethyl-ester |
| Targets: | RELA |
| MoA: | HIV integrase inhibitor |
| SMILES: | Oc1ccc(\C=C\C(=O)OCCc2ccccc2)cc1O |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 53486 | BRD-K96188950 | HEPG2 | 20 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 53624 | BRD-K96188950 | HUH7 | 20 uM | 6 h | -0.2 | -0.84 | 0.01 | -0.38 | -1.27 | 1.43 |
| 53752 | BRD-K96188950 | PHH | 20 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.32 | -1.08 | 0.81 |