CMap Candidate Details
Structure:
| CMap ID: | C00957 |
| Pert ID: | BRD-K23248433 |
| Compound Name: | camicinal |
| Targets: | MLNR |
| MoA: | motilin receptor agonist |
| SMILES: | C[C@H]1CN(Cc2ccc(CC(=O)N3CCC(CC3)Nc3cccc(F)c3)cc2)CCN1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 120892 | BRD-K23248433 | A549 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 120918 | BRD-K23248433 | HA1E | 10 uM | 24 h | 0.2 | 0.83 | 0.0 | 0.33 | 1.18 | 0.99 |
| 120968 | BRD-K23248433 | HEK293 | 0.37 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.3 | 1.07 | 0.63 |
| 120990 | BRD-K23248433 | HELA | 0.04 uM | 24 h | -0.23 | -0.97 | 0.11 | 0.0 | 0.0 | 0.0 |
| 121055 | BRD-K23248433 | MCF??7.00 | 0.37 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 121125 | BRD-K23248433 | YAPC | 10 uM | 24 h | 0.27 | 1.11 | 0.25 | 0.29 | 1.02 | 0.49 |
| 129101 | BRD-K23248433 | A375 | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 129201 | BRD-K23248433 | HT29 | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 129227 | BRD-K23248433 | PC3 | 0.01 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |