Bioactive Compound Details
| Compound ID: | B1085030 |
| Source ID: | CHEMBL1704299 |
| Source Type: | Small molecule |
| Compound Name: | |
| Synonyms: | |
| Molecular Formula: | C21H10ClNO3S |
| SMILES: | O=C1c2ccccc2C(=O)c2c1ccc1c(=O)n(-c3ccc(Cl)cc3)sc21 |
| Molecular Species: |
| Compound ID: | B1085030 |
| Source ID: | CHEMBL1704299 |
| Source Type: | Small molecule |
| Compound Name: | |
| Synonyms: | |
| Molecular Formula: | C21H10ClNO3S |
| SMILES: | O=C1c2ccccc2C(=O)c2c1ccc1c(=O)n(-c3ccc(Cl)cc3)sc21 |
| Molecular Species: |