Bioactive Compound Details
| Compound ID: | B835086 |
| Source ID: | CHEMBL1411202 |
| Source Type: | Small molecule |
| Compound Name: | |
| Synonyms: | |
| Molecular Formula: | C21H16N2O2S |
| SMILES: | O=C(NCc1ccccc1)c1cccc(-n2sc3ccccc3c2=O)c1 |
| Molecular Species: | NEUTRAL |
| Compound ID: | B835086 |
| Source ID: | CHEMBL1411202 |
| Source Type: | Small molecule |
| Compound Name: | |
| Synonyms: | |
| Molecular Formula: | C21H16N2O2S |
| SMILES: | O=C(NCc1ccccc1)c1cccc(-n2sc3ccccc3c2=O)c1 |
| Molecular Species: | NEUTRAL |