Bioactive Compound Details
| Compound ID: | B1013510 |
| Source ID: | CHEMBL1589626 |
| Source Type: | Small molecule |
| Compound Name: | |
| Synonyms: | |
| Molecular Formula: | C13H16N4S |
| SMILES: | CCc1ccccc1NC1Nc2cc(C)nn2S1 |
| Molecular Species: | NEUTRAL |
| Compound ID: | B1013510 |
| Source ID: | CHEMBL1589626 |
| Source Type: | Small molecule |
| Compound Name: | |
| Synonyms: | |
| Molecular Formula: | C13H16N4S |
| SMILES: | CCc1ccccc1NC1Nc2cc(C)nn2S1 |
| Molecular Species: | NEUTRAL |